| product Name |
N-{[(8beta,10xi)-1,6-dimethylergolin-8-yl]methyl}propanamide |
| Synonyms |
|
| Molecular Formula |
C20H27N3O |
| Molecular Weight |
325.4479 |
| InChI |
InChI=1/C20H27N3O/c1-4-19(24)21-10-13-8-16-15-6-5-7-17-20(15)14(12-23(17)3)9-18(16)22(2)11-13/h5-7,12-13,16,18H,4,8-11H2,1-3H3,(H,21,24)/t13-,16?,18+/m0/s1 |
| CAS Registry Number |
2169-46-2 |
| Molecular Structure |
|
| Density |
1.24g/cm3 |
| Boiling point |
563.2°C at 760 mmHg |
| Refractive index |
1.653 |
| Flash point |
294.4°C |
| Vapour Pressur |
1.04E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|