| product Name |
2,4-Pentanedione dioxime |
| Synonyms |
Acetylacetone dioxime; N,N'-dihydroxypentane-2,4-diimine; (2Z,4Z)-pentane-2,4-dione dioxime; (2Z,4E)-pentane-2,4-dione dioxime; (2Z)-pentane-2,4-dione dioxime |
| Molecular Formula |
C5H10N2O2 |
| Molecular Weight |
130.1451 |
| InChI |
InChI=1/C5H10N2O2/c1-4(6-8)3-5(2)7-9/h8-9H,3H2,1-2H3/b6-4-,7-5u |
| CAS Registry Number |
2157-56-4 |
| EINECS |
218-472-3 |
| Molecular Structure |
|
| Density |
1.13g/cm3 |
| Melting point |
146-148℃ |
| Boiling point |
298.8°C at 760 mmHg |
| Refractive index |
1.486 |
| Flash point |
179.3°C |
| Vapour Pressur |
0.000294mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|