| product Name |
4-Vinylbenzeneboronic acid |
| Synonyms |
4-Vinylphenylboronic acid; Styrene-4-boronic acid; (4-ethenylphenyl)boronic acid |
| Molecular Formula |
C8H9BO2 |
| Molecular Weight |
147.9669 |
| InChI |
InChI=1/C8H9BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h2-6,10-11H,1H2 |
| CAS Registry Number |
2156-04-9 |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Melting point |
188-189℃ |
| Boiling point |
306.2°C at 760 mmHg |
| Refractive index |
1.539 |
| Flash point |
139°C |
| Vapour Pressur |
0.000341mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|