product Name |
Methyl 3,4-dihydroxybenzoate |
Synonyms |
3,4-Dihydroxybenzoic acid methyl ester; Methyl protocatechuate |
Molecular Formula |
C8H8O4 |
Molecular Weight |
168.1467 |
InChI |
InChI=1/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
CAS Registry Number |
2150-43-8 |
Molecular Structure |
|
Density |
1.354g/cm3 |
Boiling point |
351.5°C at 760 mmHg |
Refractive index |
1.587 |
Flash point |
148.5°C |
Vapour Pressur |
2.02E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|