| product Name |
2,3,5,6-Tetramethylacetophenone |
| Synonyms |
-; 1-(2,3,5,6-tetramethylphenyl)ethanone |
| Molecular Formula |
C12H16O |
| Molecular Weight |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-7-6-8(2)10(4)12(9(7)3)11(5)13/h6H,1-5H3 |
| CAS Registry Number |
2142-79-2 |
| Molecular Structure |
|
| Density |
0.947g/cm3 |
| Boiling point |
281.4°C at 760 mmHg |
| Refractive index |
1.509 |
| Flash point |
115.5°C |
| Vapour Pressur |
0.00358mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
