| product Name |
4-Cyclohexylresorcinol |
| Synonyms |
-; 4-cyclohexylbenzene-1,3-diol |
| Molecular Formula |
C12H16O2 |
| Molecular Weight |
192.2542 |
| InChI |
InChI=1/C12H16O2/c13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h6-9,13-14H,1-5H2 |
| CAS Registry Number |
2138-20-7 |
| EINECS |
218-380-3 |
| Molecular Structure |
|
| Density |
1.147g/cm3 |
| Boiling point |
351°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
170.6°C |
| Vapour Pressur |
2.09E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
