| product Name |
4-Dimethylaminophenyl isothiocyanate |
| Synonyms |
Isothiocyanic acid, p-dimethylaminophenyl ester; 4-(Dimethylamino)phenyl isothiocyanate; 4-(N,N-Dimethylamino)phenyl isothiocyanate; 4-13-00-00173 (Beilstein Handbook Reference); BRN 0388270; NSC 196179; TL 1106; p-(Dimethylamino)phenyl isothiocyanate; p-(N-Dimethylamino)phenyl isothiocyanate; 4-Isothiocyanato-N,N-dimethylaniline; Benzenamine, 4-isothiocyanato-N,N-dimethyl- (9CI) |
| Molecular Formula |
C9H10N2S |
| Molecular Weight |
178.2541 |
| InChI |
InChI=1/C9H10N2S/c1-11(2)9-5-3-8(4-6-9)10-7-12/h3-6H,1-2H3 |
| CAS Registry Number |
2131-64-8 |
| EINECS |
218-360-4 |
| Molecular Structure |
|
| Density |
1.04g/cm3 |
| Boiling point |
301°C at 760 mmHg |
| Refractive index |
1.56 |
| Flash point |
135.8°C |
| Vapour Pressur |
0.00108mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
