| product Name |
3-Carboxyphenyl isothiocyanate |
| Synonyms |
3-Isothiocyanatobenzoic acid |
| Molecular Formula |
C8H5NO2S |
| Molecular Weight |
179.1958 |
| InChI |
InChI=1/C8H5NO2S/c10-8(11)6-2-1-3-7(4-6)9-5-12/h1-4H,(H,10,11) |
| CAS Registry Number |
2131-63-7 |
| Molecular Structure |
|
| Density |
1.27g/cm3 |
| Boiling point |
381.2°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
184.4°C |
| Vapour Pressur |
1.72E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|