| product Name |
stearic acid, compound with 2-aminoethanol (1:1) |
| Synonyms |
Octadecanoic acid, compd. with 2-aminoethanol (1:1); Stearic acid, compound with 2-aminoethanol (1:1); octadecanoic acid - 2-aminoethanol (1:1) |
| Molecular Formula |
C20H43NO3 |
| Molecular Weight |
345.5603 |
| InChI |
InChI=1/C18H36O2.C2H7NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3-1-2-4/h2-17H2,1H3,(H,19,20);4H,1-3H2 |
| CAS Registry Number |
2129-99-9 |
| EINECS |
218-347-3 |
| Molecular Structure |
|
| Boiling point |
359.4°C at 760 mmHg |
| Flash point |
162.4°C |
| Vapour Pressur |
8.58E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
