| product Name |
Tri-n-butylgermanium chloride |
| Synonyms |
Tributylgermanium chloride; Tri-n-butylchlorogermane; tributyl(chloro)germane; tributylgermanylium chloride |
| Molecular Formula |
C12H27ClGe |
| Molecular Weight |
279.4358 |
| InChI |
InChI=1/C12H27Ge.ClH/c1-4-7-10-13(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3;1H/q+1;/p-1 |
| CAS Registry Number |
2117-36-4 |
| EINECS |
218-323-2 |
| Molecular Structure |
|
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
