| product Name |
(R,S)-4-Pentyn-2-ol |
| Synonyms |
4-Pentyn-2-ol; pent-4-yn-2-ol |
| Molecular Formula |
C5H8O |
| Molecular Weight |
84.1164 |
| InChI |
InChI=1/C5H8O/c1-3-4-5(2)6/h1,5-6H,4H2,2H3 |
| CAS Registry Number |
2117-11-5 |
| EINECS |
218-321-1 |
| Molecular Structure |
|
| Density |
0.907g/cm3 |
| Boiling point |
126.5°C at 760 mmHg |
| Refractive index |
1.442 |
| Flash point |
37.2°C |
| Vapour Pressur |
5.35mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
