| product Name |
4-(1,3-benzoxazol-2-yl)-2-methoxyphenol |
| Synonyms |
|
| Molecular Formula |
C14H11NO3 |
| Molecular Weight |
241.242 |
| InChI |
InChI=1/C14H11NO3/c1-17-13-8-9(6-7-11(13)16)14-15-10-4-2-3-5-12(10)18-14/h2-8,16H,1H3 |
| CAS Registry Number |
3164-07-6 |
| Molecular Structure |
|
| Density |
1.288g/cm3 |
| Boiling point |
387.653°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
188.246°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|