| product Name |
6,7-dimethoxy-1-(3,4,5-trimethoxyphenyl)-3,4-dihydroisoquinoline |
| Synonyms |
|
| Molecular Formula |
C20H23NO5 |
| Molecular Weight |
357.4003 |
| InChI |
InChI=1/C20H23NO5/c1-22-15-8-12-6-7-21-19(14(12)11-16(15)23-2)13-9-17(24-3)20(26-5)18(10-13)25-4/h8-11H,6-7H2,1-5H3 |
| CAS Registry Number |
3161-21-5 |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Boiling point |
484.3°C at 760 mmHg |
| Refractive index |
1.55 |
| Flash point |
197.7°C |
| Vapour Pressur |
4.58E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|