| product Name |
2,2'-sulfanediylbis(6-bromo-4-chlorophenol) |
| Synonyms |
phenol, 2,2'-thiobis[6-bromo-4-chloro- |
| Molecular Formula |
C12H6Br2Cl2O2S |
| Molecular Weight |
444.9538 |
| InChI |
InChI=1/C12H6Br2Cl2O2S/c13-7-1-5(15)3-9(11(7)17)19-10-4-6(16)2-8(14)12(10)18/h1-4,17-18H |
| CAS Registry Number |
3161-15-7 |
| Molecular Structure |
|
| Density |
2.15g/cm3 |
| Boiling point |
447.8°C at 760 mmHg |
| Refractive index |
1.791 |
| Flash point |
224.6°C |
| Vapour Pressur |
1.24E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|