| product Name |
1,3-diphenylimidazolidine-2,4-dione |
| Synonyms |
1,3-Diphenyl-2,4-imidazolidinedione; 1,3-Diphenylimidazolidine-2,4-dione; 2,4-imidazolidinedione, 1,3-diphenyl- |
| Molecular Formula |
C15H12N2O2 |
| Molecular Weight |
252.268 |
| InChI |
InChI=1/C15H12N2O2/c18-14-11-16(12-7-3-1-4-8-12)15(19)17(14)13-9-5-2-6-10-13/h1-10H,11H2 |
| CAS Registry Number |
3157-03-7 |
| Molecular Structure |
|
| Density |
1.312g/cm3 |
| Boiling point |
380.5°C at 760 mmHg |
| Refractive index |
1.65 |
| Flash point |
167.2°C |
| Vapour Pressur |
5.41E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|