| product Name |
N-formylglycine ethyl ester |
| Synonyms |
Ethyl N-formylglycinate~For-Gly-OEt; ethyl N-formylglycinate |
| Molecular Formula |
C5H9NO3 |
| Molecular Weight |
131.1299 |
| InChI |
InChI=1/C5H9NO3/c1-2-9-5(8)3-6-4-7/h4H,2-3H2,1H3,(H,6,7) |
| CAS Registry Number |
3154-51-6 |
| EINECS |
221-596-0 |
| Molecular Structure |
|
| Density |
1.086g/cm3 |
| Boiling point |
278.4°C at 760 mmHg |
| Refractive index |
1.423 |
| Flash point |
122.2°C |
| Vapour Pressur |
0.00427mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
