product Name |
3,5-Dihydroxybenzamide |
Synonyms |
3,5-Dihydroxy Benzomide |
Molecular Formula |
C7H7NO3 |
Molecular Weight |
153.1354 |
InChI |
InChI=1/C7H7NO3/c8-7(11)4-1-5(9)3-6(10)2-4/h1-3,9-10H,(H2,8,11) |
CAS Registry Number |
3147-62-4 |
EINECS |
221-571-4 |
Molecular Structure |
|
Density |
1.458g/cm3 |
Boiling point |
452.4°C at 760 mmHg |
Refractive index |
1.664 |
Flash point |
227.4°C |
Vapour Pressur |
8.43E-09mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|