| product Name |
Methyl 2,4,6-trihydroxybenzoate |
| Synonyms |
Methyl 3,4,5-trimethoxybenzoate; 2,4,6-Trihydroxybenzoic acid methyl ester; Phloroglucinolcarboxylic acid methyl ester |
| Molecular Formula |
C8H8O5 |
| Molecular Weight |
184.1461 |
| InChI |
InChI=1/C8H8O5/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3,9-11H,1H3 |
| CAS Registry Number |
3147-39-5 |
| EINECS |
221-566-7 |
| Molecular Structure |
|
| Density |
1.501g/cm3 |
| Melting point |
174-176℃ |
| Boiling point |
359.5°C at 760 mmHg |
| Refractive index |
1.63 |
| Flash point |
150.3°C |
| Vapour Pressur |
1.14E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
