| product Name |
4-acetylbutyric acid |
| Synonyms |
5-oxohexanoic acid; Ketohexanoicacid; 5-Ketohexanoic acid~5-Oxohexanoic acid; 5-Ketohexanoic acid |
| Molecular Formula |
C6H10O3 |
| Molecular Weight |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-5(7)3-2-4-6(8)9/h2-4H2,1H3,(H,8,9) |
| CAS Registry Number |
3128-06-1 |
| EINECS |
221-511-7 |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Melting point |
13-14℃ |
| Boiling point |
275.5°C at 760 mmHg |
| Refractive index |
1.439 |
| Flash point |
134.6°C |
| Vapour Pressur |
0.00139mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
