product Name |
3-cyanophenyl isothiocyanate |
Synonyms |
3-Isothiocyanatobenzonitrile |
Molecular Formula |
C8H4N2S |
Molecular Weight |
160.1958 |
InChI |
InChI=1/C8H4N2S/c9-5-7-2-1-3-8(4-7)10-6-11/h1-4H |
CAS Registry Number |
3125-78-8 |
Molecular Structure |
|
Density |
1.12g/cm3 |
Melting point |
64-66℃ |
Boiling point |
303.1°C at 760 mmHg |
Refractive index |
1.604 |
Flash point |
137.1°C |
Vapour Pressur |
0.000953mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|