| product Name |
3-Iodophenyl isothiocyanate |
| Synonyms |
3-Iodophenylisothiocyanate; 1-Iodo-3-isothiocyanatobenzene; 3-IPI; Isothiocyanic acid, m-iodophenyl ester; m-Iodophenylisothiocyanate; Benzene, 1-iodo-3-isothiocyanato- |
| Molecular Formula |
C7H4INS |
| Molecular Weight |
261.0828 |
| InChI |
InChI=1/C7H4INS/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| CAS Registry Number |
3125-73-3 |
| Molecular Structure |
|
| Density |
1.76g/cm3 |
| Boiling point |
318.1°C at 760 mmHg |
| Refractive index |
1.672 |
| Flash point |
146.2°C |
| Vapour Pressur |
0.000689mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|