| product Name |
3-Methoxycarbonylphenyl isothiocyanate |
| Synonyms |
Methyl 3-isothiocyanatobenzoate |
| Molecular Formula |
C9H7NO2S |
| Molecular Weight |
193.2224 |
| InChI |
InChI=1/C9H7NO2S/c1-12-9(11)7-3-2-4-8(5-7)10-6-13/h2-5H,1H3 |
| CAS Registry Number |
3125-66-4 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Boiling point |
323.2°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
149.2°C |
| Vapour Pressur |
0.000267mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
