product Name |
9-Chlorophenanthrene |
Synonyms |
Phenanthrene, 9-chloro-; 10-Chlorophenanthrene; 4-05-00-02303 (Beilstein Handbook Reference); AI3-24095; BRN 2047058; CCRIS 5543; NSC 8552 |
Molecular Formula |
C14H9Cl |
Molecular Weight |
212.6743 |
InChI |
InChI=1/C14H9Cl/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
CAS Registry Number |
947-72-8 |
EINECS |
213-430-0 |
Molecular Structure |
|
Density |
1.253g/cm3 |
Melting point |
46-50℃ |
Boiling point |
370.1°C at 760 mmHg |
Refractive index |
1.717 |
Flash point |
179.2°C |
Vapour Pressur |
2.42E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|