| product Name |
9-Chlorophenanthrene |
| Synonyms |
Phenanthrene, 9-chloro-; 10-Chlorophenanthrene; 4-05-00-02303 (Beilstein Handbook Reference); AI3-24095; BRN 2047058; CCRIS 5543; NSC 8552 |
| Molecular Formula |
C14H9Cl |
| Molecular Weight |
212.6743 |
| InChI |
InChI=1/C14H9Cl/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| CAS Registry Number |
947-72-8 |
| EINECS |
213-430-0 |
| Molecular Structure |
|
| Density |
1.253g/cm3 |
| Melting point |
46-50℃ |
| Boiling point |
370.1°C at 760 mmHg |
| Refractive index |
1.717 |
| Flash point |
179.2°C |
| Vapour Pressur |
2.42E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
