| product Name |
N-Ethylmaleamic acid |
| Synonyms |
Maleic acid monoethylamide; (2E)-4-(ethylamino)-4-oxobut-2-enoic acid; (2Z)-4-(ethylamino)-4-oxobut-2-enoic acid |
| Molecular Formula |
C6H9NO3 |
| Molecular Weight |
143.1406 |
| InChI |
InChI=1/C6H9NO3/c1-2-7-5(8)3-4-6(9)10/h3-4H,2H2,1H3,(H,7,8)(H,9,10)/b4-3- |
| CAS Registry Number |
4166-67-0 |
| EINECS |
224-021-1 |
| Molecular Structure |
|
| Density |
1.175g/cm3 |
| Melting point |
123-125℃ |
| Boiling point |
375°C at 760 mmHg |
| Refractive index |
1.488 |
| Flash point |
180.6°C |
| Vapour Pressur |
1.18E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|