| product Name |
3-Methylglutaric anhydride |
| Synonyms |
-; 4-methyldihydro-2H-pyran-2,6(3H)-dione |
| Molecular Formula |
C6H8O3 |
| Molecular Weight |
128.1259 |
| InChI |
InChI=1/C6H8O3/c1-4-2-5(7)9-6(8)3-4/h4H,2-3H2,1H3 |
| CAS Registry Number |
4166-53-4 |
| EINECS |
224-020-6 |
| Molecular Structure |
|
| Density |
1.159g/cm3 |
| Melting point |
40-45℃ |
| Boiling point |
299.5°C at 760 mmHg |
| Refractive index |
1.448 |
| Flash point |
113°C |
| Vapour Pressur |
0.00119mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
