| product Name |
1,4-Piperazinedicarboxaldehyde |
| Synonyms |
1,4-Diformylpiperazine; piperazine-1,4-dicarbaldehyde |
| Molecular Formula |
C6H10N2O2 |
| Molecular Weight |
142.1558 |
| InChI |
InChI=1/C6H10N2O2/c9-5-7-1-2-8(6-10)4-3-7/h5-6H,1-4H2 |
| CAS Registry Number |
4164-39-0 |
| EINECS |
224-011-7 |
| Molecular Structure |
|
| Density |
1.397g/cm3 |
| Melting point |
125-129℃ |
| Boiling point |
373.1°C at 760 mmHg |
| Refractive index |
1.688 |
| Flash point |
194.5°C |
| Vapour Pressur |
9.17E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
