product Name |
1-chloro-3-methoxy-2-propanol |
Synonyms |
3-Chloro-1-methoxy-2-propanol; 1-chloro-3-methoxypropan-2-ol |
Molecular Formula |
C4H9ClO2 |
Molecular Weight |
124.5661 |
InChI |
InChI=1/C4H9ClO2/c1-7-3-4(6)2-5/h4,6H,2-3H2,1H3 |
CAS Registry Number |
4151-97-7 |
EINECS |
223-982-4 |
Molecular Structure |
|
Density |
1.13g/cm3 |
Boiling point |
181.6°C at 760 mmHg |
Refractive index |
1.433 |
Flash point |
63.6°C |
Vapour Pressur |
0.247mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36:Irritating to eyes.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|