| product Name |
2-Benzylcyclohexanone |
| Synonyms |
2-Benzylcyclohexan-1-one |
| Molecular Formula |
C13H16O |
| Molecular Weight |
188.2655 |
| InChI |
InChI=1/C13H16O/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2 |
| CAS Registry Number |
946-33-8 |
| EINECS |
213-420-6 |
| Molecular Structure |
|
| Density |
1.038g/cm3 |
| Boiling point |
303.3°C at 760 mmHg |
| Refractive index |
1.541 |
| Flash point |
127.5°C |
| Vapour Pressur |
0.000939mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
