product Name |
2-Benzylcyclohexanone |
Synonyms |
2-Benzylcyclohexan-1-one |
Molecular Formula |
C13H16O |
Molecular Weight |
188.2655 |
InChI |
InChI=1/C13H16O/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2 |
CAS Registry Number |
946-33-8 |
EINECS |
213-420-6 |
Molecular Structure |
|
Density |
1.038g/cm3 |
Boiling point |
303.3°C at 760 mmHg |
Refractive index |
1.541 |
Flash point |
127.5°C |
Vapour Pressur |
0.000939mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|