| product Name |
3',4'-Dihydroxyflavone |
| Synonyms |
4-Hydroxyflavonol; 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-; 2-(3,4-dihydroxyphenyl)-4H-chromen-4-one |
| Molecular Formula |
C15H10O4 |
| Molecular Weight |
254.2375 |
| InChI |
InChI=1/C15H10O4/c16-11-6-5-9(7-13(11)18)15-8-12(17)10-3-1-2-4-14(10)19-15/h1-8,16,18H |
| CAS Registry Number |
4143-64-0 |
| Molecular Structure |
|
| Density |
1.443g/cm3 |
| Boiling point |
482.3°C at 760 mmHg |
| Refractive index |
1.698 |
| Flash point |
188.4°C |
| Vapour Pressur |
6.34E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|