4122-68-3 4-Chlorophenoxyacetyl chloride
cas

4122-68-3 4-Chlorophenoxyacetyl chloride

product Name 4-Chlorophenoxyacetyl chloride
Synonyms (4-Chlorophenoxy)acetyl chloride
Molecular Formula C8H6Cl2O2
Molecular Weight 205.038
InChI InChI=1/C8H6Cl2O2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2
CAS Registry Number 4122-68-3
EINECS 223-923-2
Molecular Structure 4122-68-3 4-Chlorophenoxyacetyl chloride
Density 1.363g/cm3
Melting point 18.8℃
Boiling point 264.5°C at 760 mmHg
Refractive index 1.542
Flash point 112.9°C
Vapour Pressur 0.00965mmHg at 25°C
Hazard Symbols  C:Corrosive;
Risk Codes R34:Causes burns.;
Safety Description S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
1 2 3 4 5 6 7 8 9