product Name |
4-Chlorophenoxyacetyl chloride |
Synonyms |
(4-Chlorophenoxy)acetyl chloride |
Molecular Formula |
C8H6Cl2O2 |
Molecular Weight |
205.038 |
InChI |
InChI=1/C8H6Cl2O2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2 |
CAS Registry Number |
4122-68-3 |
EINECS |
223-923-2 |
Molecular Structure |
|
Density |
1.363g/cm3 |
Melting point |
18.8℃ |
Boiling point |
264.5°C at 760 mmHg |
Refractive index |
1.542 |
Flash point |
112.9°C |
Vapour Pressur |
0.00965mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|