| product Name |
sym-Dicarbethoxyhydrazine |
| Synonyms |
Diethyl 1,2-hydrazinedicarboxylate; 1,2-dicarbethoxyhydrazine; diethyl bicarbamate; bis(ethoxycarbonyl)hydrazine; Diethyl hydrazodicarboxylate; N,N-Dicarboethoxyhydrazine~Diethyl hydrazodiformate~Hydrazine-N,N-dicarboxylic acid diethyl ester; 1,2-Hydrazinedicarboxylic acid diethyl ester; diethyl hydrazine-1,2-dicarboxylate |
| Molecular Formula |
C6H12N2O4 |
| Molecular Weight |
176.1705 |
| InChI |
InChI=1/C6H12N2O4/c1-3-11-5(9)7-8-6(10)12-4-2/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
| CAS Registry Number |
4114-28-7 |
| EINECS |
223-902-8 |
| Molecular Structure |
|
| Density |
1.157g/cm3 |
| Melting point |
130-135℃ |
| Boiling point |
250°C at 760 mmHg |
| Refractive index |
1.446 |
| Flash point |
105°C |
| Vapour Pressur |
0.0222mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
