| product Name |
desmetryn |
| Synonyms |
6-isopropylamino-2-methylamino-4-methylthio-1,3,5-triazine; N-methyl-6-(methylsulfanyl)-N'-(propan-2-yl)-1,3,5-triazine-2,4-diamine |
| Molecular Formula |
C8H15N5S |
| Molecular Weight |
213.3032 |
| InChI |
InChI=1/C8H15N5S/c1-5(2)10-7-11-6(9-3)12-8(13-7)14-4/h5H,1-4H3,(H2,9,10,11,12,13) |
| CAS Registry Number |
1014-69-3 |
| EINECS |
213-800-1 |
| Molecular Structure |
|
| Density |
1.18g/cm3 |
| Boiling point |
385.6°C at 760 mmHg |
| Refractive index |
1.563 |
| Flash point |
187°C |
| Vapour Pressur |
3.75E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|