| product Name |
3-(3-chlorophenyl)-1,3-thiazolidine-2,4-dione |
| Synonyms |
2,4-thiazolidinedione, 3-(3-chlorophenyl)-; 3-(3-Chloro-phenyl)-thiazolidine-2,4-dione |
| Molecular Formula |
C9H6ClNO2S |
| Molecular Weight |
227.6674 |
| InChI |
InChI=1/C9H6ClNO2S/c10-6-2-1-3-7(4-6)11-8(12)5-14-9(11)13/h1-4H,5H2 |
| CAS Registry Number |
1013-68-9 |
| Molecular Structure |
|
| Density |
1.534g/cm3 |
| Boiling point |
365.4°C at 760 mmHg |
| Refractive index |
1.665 |
| Flash point |
174.8°C |
| Vapour Pressur |
1.58E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|