| product Name |
Dimethylphenylpiperazine |
| Synonyms |
1-(2,6-Dimethylphenyl)piperazine |
| Molecular Formula |
C12H18N2 |
| Molecular Weight |
190.2847 |
| InChI |
InChI=1/C12H18N2/c1-10-4-3-5-11(2)12(10)14-8-6-13-7-9-14/h3-5,13H,6-9H2,1-2H3 |
| CAS Registry Number |
1012-91-5 |
| EINECS |
213-791-4 |
| Molecular Structure |
|
| Density |
0.999g/cm3 |
| Boiling point |
315°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
138.3°C |
| Vapour Pressur |
0.000451mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|