| product Name |
sodium 2-hydroxy-6-methyl-3-(propan-2-yl)benzoate |
| Synonyms |
benzoic acid, 2-hydroxy-6-methyl-3-(1-methylethyl)-, sodium salt (1:1); Sodium 2-hydroxy-3-isopropyl-6-methylbenzoate |
| Molecular Formula |
C11H13NaO3 |
| Molecular Weight |
216.2089 |
| InChI |
InChI=1/C11H14O3.Na/c1-6(2)8-5-4-7(3)9(10(8)12)11(13)14;/h4-6,12H,1-3H3,(H,13,14);/q;+1/p-1 |
| CAS Registry Number |
1012-86-8 |
| Molecular Structure |
|
| Boiling point |
316.3°C at 760 mmHg |
| Flash point |
159.3°C |
| Vapour Pressur |
0.000174mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|