product Name |
4-amino-2,3,5,6-tetrafluorobenzoic acid |
Synonyms |
- |
Molecular Formula |
C7H3F4NO2 |
Molecular Weight |
209.0978 |
InChI |
InChI=1/C7H3F4NO2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H,13,14) |
CAS Registry Number |
944-43-4 |
EINECS |
213-409-6 |
Molecular Structure |
|
Density |
1.726g/cm3 |
Melting point |
185-187℃ |
Boiling point |
283.6°C at 760 mmHg |
Refractive index |
1.529 |
Flash point |
125.3°C |
Vapour Pressur |
0.00148mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|