| product Name |
2-methoxyquinazolin-4(1H)-one |
| Synonyms |
2-Methoxyquinazolin-4-ol; 4-quinazolinol, 2-methoxy- |
| Molecular Formula |
C9H8N2O2 |
| Molecular Weight |
176.172 |
| InChI |
InChI=1/C9H8N2O2/c1-13-9-10-7-5-3-2-4-6(7)8(12)11-9/h2-5H,1H3,(H,10,11,12) |
| CAS Registry Number |
1011-24-1 |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Boiling point |
303.5°C at 760 mmHg |
| Refractive index |
1.627 |
| Flash point |
137.3°C |
| Vapour Pressur |
0.00093mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|