| product Name |
2-cyclohexylidenecyclohexanone |
| Synonyms |
Cyclohexanone, 2-cyclohexylidene-; 2-Cyclohexylidenecyclohexanone; AI3-04026; Bicyclohexyliden-2-one; Dianon; NSC 61652; 1,1'-bi(cyclohexyliden)-2-one |
| Molecular Formula |
C12H18O |
| Molecular Weight |
178.2707 |
| InChI |
InChI=1/C12H18O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H2 |
| CAS Registry Number |
1011-12-7 |
| EINECS |
213-779-9 |
| Molecular Structure |
|
| Density |
1.034g/cm3 |
| Boiling point |
295°C at 760 mmHg |
| Refractive index |
1.528 |
| Flash point |
122.4°C |
| Vapour Pressur |
0.00156mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|