| product Name |
3-phenylthiazolidine-2,4-dione |
| Synonyms |
2,4-thiazolidinedione, 3-phenyl-; 3-Phenyl-2,4-thiazolidinedione; 3-phenyl-1,3-thiazolidine-2,4-dione |
| Molecular Formula |
C9H7NO2S |
| Molecular Weight |
193.2224 |
| InChI |
InChI=1/C9H7NO2S/c11-8-6-13-9(12)10(8)7-4-2-1-3-5-7/h1-5H,6H2 |
| CAS Registry Number |
1010-53-3 |
| Molecular Structure |
|
| Density |
1.416g/cm3 |
| Boiling point |
315.1°C at 760 mmHg |
| Refractive index |
1.658 |
| Flash point |
144.4°C |
| Vapour Pressur |
0.000446mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|