| product Name |
Piperazine, 1,4-bis(2-chloroethyl)- (6CI,7CI,8CI,9CI) |
| Synonyms |
Piperazine, 1,4-bis(2-chloroethyl)-; 1,4-Bis(2-chloroethyl)piperazine; 5-23-01-00138 (Beilstein Handbook Reference); BRN 0108239; N,N'-Bis(2-chloroethyl)piperazine |
| Molecular Formula |
C8H16Cl2N2 |
| Molecular Weight |
211.132 |
| InChI |
InChI=1/C8H16Cl2N2/c9-1-3-11-5-7-12(4-2-10)8-6-11/h1-8H2 |
| CAS Registry Number |
1009-85-4 |
| Molecular Structure |
|
| Density |
1.132g/cm3 |
| Boiling point |
288.4°C at 760 mmHg |
| Refractive index |
1.49 |
| Flash point |
128.2°C |
| Vapour Pressur |
0.00234mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|