| product Name |
4-Fluoro-3-nitrobenzonitrile |
| Synonyms |
3-Nitro-4-fluorobenzonitrile; 1-(2-fluorophenyl)piperazine |
| Molecular Formula |
C10H13FN2 |
| Molecular Weight |
180.222 |
| InChI |
InChI=1/C10H13FN2/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13/h1-4,12H,5-8H2 |
| CAS Registry Number |
1009-35-4 |
| EINECS |
213-780-4 |
| Molecular Structure |
|
| Density |
1.112g/cm3 |
| Boiling point |
283.8°C at 760 mmHg |
| Refractive index |
1.527 |
| Flash point |
125.4°C |
| Vapour Pressur |
0.0031mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|