| product Name |
Gamma-Phenyl-Gamma-butyrolactone |
| Synonyms |
4,5-Dihydro-5-phenyl-2(3H)-furanone; 5-phenyldihydrofuran-2(3H)-one; (5R)-5-phenyldihydrofuran-2(3H)-one; (5S)-5-phenyldihydrofuran-2(3H)-one |
| Molecular Formula |
C10H10O2 |
| Molecular Weight |
162.1852 |
| InChI |
InChI=1/C10H10O2/c11-10-7-6-9(12-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-/m0/s1 |
| CAS Registry Number |
1008-76-0 |
| EINECS |
213-761-0 |
| Molecular Structure |
|
| Density |
1.154g/cm3 |
| Melting point |
36-37℃ |
| Boiling point |
306°C at 760 mmHg |
| Refractive index |
1.548 |
| Flash point |
135.5°C |
| Vapour Pressur |
0.000793mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
