| product Name |
1,2-Epoxy-5,9-cyclododecadiene |
| Molecular Formula |
C12H18O |
| Molecular Weight |
178.2707 |
| InChI |
InChI=1/C12H18O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h3-6,11-12H,1-2,7-10H2/b5-3+,6-4+ |
| CAS Registry Number |
943-93-1 |
| EINECS |
213-407-5 |
| Molecular Structure |
|
| Density |
0.941g/cm3 |
| Boiling point |
269.8°C at 760 mmHg |
| Refractive index |
1.484 |
| Flash point |
113.6°C |
| Vapour Pressur |
0.0118mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
