product Name |
1,2-Epoxy-5,9-cyclododecadiene |
Molecular Formula |
C12H18O |
Molecular Weight |
178.2707 |
InChI |
InChI=1/C12H18O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h3-6,11-12H,1-2,7-10H2/b5-3+,6-4+ |
CAS Registry Number |
943-93-1 |
EINECS |
213-407-5 |
Molecular Structure |
|
Density |
0.941g/cm3 |
Boiling point |
269.8°C at 760 mmHg |
Refractive index |
1.484 |
Flash point |
113.6°C |
Vapour Pressur |
0.0118mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|