| product Name |
5-methoxy-1,2,3,4-tetrahydronaphthalene |
| Synonyms |
5-Methoxy-1,2,3,4-tetrahydronaphthalene; Methyl 5,6,7,8-tetrahydronaphthalen-1-yl ether; naphthalene, 1,2,3,4-tetrahydro-5-methoxy- |
| Molecular Formula |
C11H14O |
| Molecular Weight |
162.2283 |
| InChI |
InChI=1/C11H14O/c1-12-11-8-4-6-9-5-2-3-7-10(9)11/h4,6,8H,2-3,5,7H2,1H3 |
| CAS Registry Number |
1008-19-1 |
| Molecular Structure |
|
| Density |
1.012g/cm3 |
| Boiling point |
271.7°C at 760 mmHg |
| Refractive index |
1.532 |
| Flash point |
111.8°C |
| Vapour Pressur |
0.0106mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|