| product Name |
7-CHLORO-3-FORMYLINDOLE |
| Synonyms |
1H-indole-3-carboxaldehyde, 7-chloro-; 7-Chloro-1H-indole-3-carbaldehyde |
| Molecular Formula |
C9H6ClNO |
| Molecular Weight |
179.603 |
| InChI |
InChI=1/C9H6ClNO/c10-8-3-1-2-7-6(5-12)4-11-9(7)8/h1-5,11H |
| CAS Registry Number |
1008-07-7 |
| Molecular Structure |
|
| Density |
1.431g/cm3 |
| Boiling point |
373.4°C at 760 mmHg |
| Refractive index |
1.731 |
| Flash point |
179.6°C |
| Vapour Pressur |
8.99E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|