| product Name |
Cyclopropyl phenyl carbinol |
| Synonyms |
alpha-Cyclopropylbenzenemethanol; Cyclopropyl phenyl carbinol~Cyclopropylphenylmethanol; alpha-Cyclopropylbenzyl alcohol; cyclopropyl(phenyl)methanol; (R)-cyclopropyl(phenyl)methanol; (S)-cyclopropyl(phenyl)methanol |
| Molecular Formula |
C10H12O |
| Molecular Weight |
148.2017 |
| InChI |
InChI=1/C10H12O/c11-10(9-6-7-9)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2/t10-/m1/s1 |
| CAS Registry Number |
1007-03-0 |
| EINECS |
213-749-5 |
| Molecular Structure |
|
| Density |
1.141g/cm3 |
| Boiling point |
248.9°C at 760 mmHg |
| Refractive index |
1.602 |
| Flash point |
112.2°C |
| Vapour Pressur |
0.0124mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
