product Name |
2-Norbornane acetic acid |
Synonyms |
norborn-2-ylacetic acid; Bicyclo[2.2.1]hept-2-ylacetic acid; (1R,2R,4S)-bicyclo[2.2.1]hept-2-ylacetate; (1S,2R,4R)-bicyclo[2.2.1]hept-2-ylacetic acid; (1S,2R,4R)-bicyclo[2.2.1]hept-2-ylacetate |
Molecular Formula |
C9H13O2 |
Molecular Weight |
153.1989 |
InChI |
InChI=1/C9H14O2/c10-9(11)5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2,(H,10,11)/p-1/t6-,7+,8-/m1/s1 |
CAS Registry Number |
1007-01-8 |
EINECS |
213-747-4 |
Molecular Structure |
|
Boiling point |
252.29°C at 760 mmHg |
Flash point |
133.366°C |
Vapour Pressur |
0.006mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|