| product Name |
5-PHENYLOXAZOLE |
| Synonyms |
5-PHENYL-1,3-OXAZOLE; 5-PHENYLOXAZOLE 95% |
| Molecular Formula |
C9H7NO |
| Molecular Weight |
145.158 |
| InChI |
InChI=1/C9H7NO/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-7H |
| CAS Registry Number |
1006-68-4 |
| Molecular Structure |
|
| Density |
1.11g/cm3 |
| Melting point |
37-39℃ |
| Boiling point |
261.6°C at 760 mmHg |
| Refractive index |
1.543 |
| Flash point |
102.8°C |
| Vapour Pressur |
0.0186mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
|
| Safety Description |
S24/25:;
|
|