| product Name |
3-methyl-3,7-dihydro-6H-purin-6-one |
| Molecular Formula |
C6H6N4O |
| Molecular Weight |
150.138 |
| InChI |
InChI=1/C6H6N4O/c1-10-3-9-6(11)4-5(10)8-2-7-4/h2-3H,1H3,(H,7,8) |
| CAS Registry Number |
1006-11-7 |
| Molecular Structure |
|
| Density |
1.6g/cm3 |
| Boiling point |
470°C at 760 mmHg |
| Refractive index |
1.772 |
| Flash point |
238.1°C |
| Vapour Pressur |
5.24E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|