| product Name |
2-(chloromethyl)-2-phenyloxirane |
| Synonyms |
2-(Chloromethyl)-2-phenyloxirane; Oxirane, 2-(chloromethyl)-2-phenyl- |
| Molecular Formula |
C9H9ClO |
| Molecular Weight |
168.6202 |
| InChI |
InChI=1/C9H9ClO/c10-6-9(7-11-9)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| CAS Registry Number |
1005-91-0 |
| Molecular Structure |
|
| Density |
1.21g/cm3 |
| Boiling point |
256.4°C at 760 mmHg |
| Refractive index |
1.554 |
| Flash point |
73.5°C |
| Vapour Pressur |
0.0248mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|